CymitQuimica logo

CAS 100596-16-5

:

3-(1,3-dithian-2-yl)pentane-2,4-dione

Description:
3-(1,3-Dithian-2-yl)pentane-2,4-dione is an organic compound characterized by its unique structure, which includes a pentane backbone with a diketone functional group and a 1,3-dithiane substituent. The presence of the diketone moiety contributes to its reactivity, particularly in nucleophilic addition reactions, making it a valuable intermediate in organic synthesis. The 1,3-dithiane group enhances the compound's stability and solubility in various organic solvents, which is beneficial for its applications in chemical reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure allows for potential applications in medicinal chemistry and materials science, particularly in the synthesis of more complex molecules. Additionally, the compound's properties, such as boiling point, melting point, and solubility, can vary based on environmental factors and the presence of other functional groups in related compounds. Overall, 3-(1,3-dithian-2-yl)pentane-2,4-dione is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C9H14O2S2
InChI:InChI=1/C9H14O2S2/c1-6(10)8(7(2)11)9-12-4-3-5-13-9/h8-9H,3-5H2,1-2H3
SMILES:CC(=O)C(C(=O)C)C1SCCCS1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.