CAS 100599-91-5
:4-Methylthiazol-2-ylguanidine hydrochloride
Description:
4-Methylthiazol-2-ylguanidine hydrochloride is a chemical compound characterized by its unique structure, which includes a thiazole ring and a guanidine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in biological and chemical research. It is known for its potential biological activities, including antimicrobial and antifungal properties, which make it of interest in pharmaceutical development. The presence of the methyl group on the thiazole ring contributes to its chemical reactivity and interaction with biological targets. Additionally, the guanidine group is known for its basicity and ability to form hydrogen bonds, which can influence the compound's pharmacokinetic properties. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use. Overall, 4-Methylthiazol-2-ylguanidine hydrochloride represents a valuable compound in the field of medicinal chemistry and biochemistry.
Formula:C5H9ClN4S
InChI:InChI=1/C5H8N4S.ClH/c1-3-2-10-5(8-3)9-4(6)7;/h2H,1H3,(H4,6,7,8,9);1H
SMILES:Cc1csc(n1)NC(=N)N.Cl
Synonyms:- 2-(4-Methyl-1,3-Thiazol-2-Yl)Guanidine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-(4-Methylthiazol-2-yl)guanidine hydrochloride
CAS:Formula:C5H9ClN4SColor and Shape:SolidMolecular weight:192.66981-(4-Methyl-1,3-thiazol-2-yl)guanidine hydrochloride
CAS:1-(4-Methyl-1,3-thiazol-2-yl)guanidine hydrochlorideFormula:C5H8N4S·ClHPurity:95%Color and Shape: cream granules/ powderMolecular weight:192.67g/molFamotidine Impurity 1 HCl
CAS:Formula:C5H8N4S·HClColor and Shape:White To Off-White SolidMolecular weight:156.21 36.46N-(4-Methyl-1,3-thiazol-2-yl)guanidine hydrochloride
CAS:Formula:C5H9ClN4SPurity:97.0%Color and Shape:Solid, CrystallineMolecular weight:192.67N-(4-Methyl-2-thiazolyl)-guanidine hydrochloride
CAS:Controlled ProductApplications N-(4-Methyl-2-thiazolyl)-guanidine hydrochloride is the hydrochloride base salt of N-(4-Methyl-2-thiazolyl)-guanidine which is used as a test compound for various studies involving permeability through the blood-brain barrier.
References Bolboaca, S.D., et al.: Int. J. Mol. Sci., 12, 4348-64 (2011); Dureja, H., et al.: Acta Pharm. 57, 451-67 (2007); Fu, X., et al.: nt. J. Mol. Sci., 10, 737-50 (2005)Formula:C5H8N4S·HClColor and Shape:NeatMolecular weight:192.67N-(4-Methyl-1,3-thiazol-2-yl)-guanidine hydrochloride
CAS:Versatile small molecule scaffoldFormula:C5H9ClN4SPurity:Min. 95%Molecular weight:192.67 g/mol






