CAS 1006-11-7
:3-methyl-3,7-dihydro-6H-purin-6-one
Description:
3-Methyl-3,7-dihydro-6H-purin-6-one, commonly known as 3-methylxanthine, is a purine derivative characterized by its bicyclic structure that includes a fused imidazole and pyrimidine ring. This compound features a methyl group at the 3-position and a carbonyl group at the 6-position, contributing to its classification as a xanthine derivative. It is a white to off-white crystalline solid that is soluble in water and organic solvents, reflecting its polar nature due to the presence of nitrogen atoms in the ring structure. 3-Methylxanthine is known for its biological activity, particularly as a stimulant, and is involved in various metabolic processes. It is a product of caffeine metabolism and has been studied for its potential effects on the central nervous system, as well as its role in the modulation of various physiological functions. The compound's pharmacological properties make it of interest in both medicinal chemistry and biochemistry, particularly in the context of its effects on adenosine receptors and its potential therapeutic applications.
Formula:C6H6N4O
InChI:InChI=1/C6H6N4O/c1-10-3-9-6(11)4-5(10)8-2-7-4/h2-3H,1H3,(H,7,8)
SMILES:Cn1cnc(=O)c2c1[nH]cn2
Synonyms:- 3-Methyl-7H-Purin-6(3H)-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
