CAS 1006-12-8
:3-methyl-3,7-dihydro-6H-purine-6-thione
Description:
3-Methyl-3,7-dihydro-6H-purine-6-thione, with the CAS number 1006-12-8, is a purine derivative characterized by its unique structural features, including a methyl group at the 3-position and a thione functional group at the 6-position of the purine ring. This compound typically appears as a crystalline solid and is soluble in polar solvents. Its molecular structure contributes to its biological activity, as purine derivatives often play significant roles in nucleic acid metabolism and cellular signaling. The thione group can influence the compound's reactivity and stability, making it of interest in medicinal chemistry and pharmacology. Additionally, 3-methyl-3,7-dihydro-6H-purine-6-thione may exhibit various biological properties, including potential antimicrobial or antiviral activities, although specific biological effects would depend on further empirical studies. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C6H6N4S
InChI:InChI=1/C6H6N4S/c1-10-3-9-6(11)4-5(10)8-2-7-4/h2-3H,1H3,(H,7,8)
SMILES:Cn1cnc(=S)c2c1[nH]cn2
Synonyms:- 3,7-Dihydro-3-Methyl-6H-Purine-6-Thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
