CAS 1006-20-8
:9-METHYL-6-THIOPURINE
Description:
9-Methyl-6-thiopurine, with the CAS number 1006-20-8, is a purine derivative characterized by the presence of a methyl group at the 9-position and a thiol group at the 6-position of the purine ring. This compound is part of a class of substances known as thiopurines, which are often studied for their potential pharmacological applications, particularly in the context of immunosuppressive therapy and cancer treatment. The presence of the sulfur atom in the thiopurine structure can influence its reactivity and biological activity. 9-Methyl-6-thiopurine is typically a crystalline solid at room temperature and may exhibit solubility in polar solvents. Its chemical properties, such as stability and reactivity, can be affected by the functional groups present, making it an interesting subject for research in medicinal chemistry. Additionally, the compound's interactions with biological systems, including its metabolism and mechanism of action, are of significant interest in the development of therapeutic agents.
Formula:C6H6N4S
InChI:InChI=1/C6H6N4S/c1-10-3-9-4-5(10)7-2-8-6(4)11/h2-3H,1H3,(H,7,8,11)
Synonyms:- METHYL-6-MERCAPTOPURINE, 9-
- 6-Mercapto-9-methylpurine
- 9-Methyl-1,9-dihydro-6H-purine-6-thione
- 6H-Purine-6-thione, 1,9-dihydro-9-methyl-
- 9-methyl-3,9-dihydro-6H-purine-6-thione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
9-Methyl-9H-purine-6-thiol
CAS:9-Methyl-9H-purine-6-thiol is a photochemically reactive molecule that absorbs in the ultraviolet range. It is a nucleophilic, photophysical, and tautomeric molecule. This chemical is used to treat cancer by reacting with DNA bases. 9-Methyl-9H-purine-6-thiol can also react with thiols and form a covalent bond. The rate of this reaction increases when the pH of the solution decreases from 7 to 6.5 and it slows down when the pH is increased from 6.5 to 8. The UV spectrum for 9-methyl-9H-purine-6-thiol has been found at 215 nm, 270 nm, and 310 nm. High concentrations of this compound should be avoided because it may cause skin irritation or an allergic reaction.
Formula:C6H6N4SPurity:Min. 95%Molecular weight:166.21 g/molRef: 3D-BAA00620
Discontinued product
