CAS 1006-29-7
:1H-Indazole-1-methanol
Description:
1H-Indazole-1-methanol, with the CAS number 1006-29-7, is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a hydroxymethyl group (-CH2OH) attached to the nitrogen-containing ring, which contributes to its reactivity and potential applications in various chemical reactions. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group. The compound exhibits moderate stability under standard conditions but may undergo reactions typical of indazole derivatives, including electrophilic substitutions and nucleophilic attacks. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives have been associated with various biological activities. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c11-6-10-8-4-2-1-3-7(8)5-9-10/h1-5,11H,6H2
InChI key:InChIKey=RMUBNCHBHNTGPS-UHFFFAOYSA-N
SMILES:C(O)N1C=2C(C=N1)=CC=CC2
Synonyms:- 1H-Indazole-1-methanol
- 1H-Indazol-1-ylmethanol
- Indazol-1-ylmethanol
- 1-(Hydroxymethyl)indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Indazol-1-ylmethanol
CAS:Controlled ProductStability Unstable in aqueous media
Applications 1H-indazol-1-ylmethanol (cas# 1006-29-7) is a useful research chemical.Formula:C8H8N2OColor and Shape:NeatMolecular weight:148.16
