CAS 1006-32-2
:1,2,3,4-tetrachloro-5-methylbenzene
Description:
1,2,3,4-Tetrachloro-5-methylbenzene, also known as chlorinated aromatic compound, is characterized by its four chlorine atoms and a methyl group attached to a benzene ring. This compound is a colorless to pale yellow liquid with a distinctive odor. It is relatively insoluble in water but soluble in organic solvents, which is typical for chlorinated hydrocarbons. The presence of multiple chlorine atoms significantly increases its density compared to non-chlorinated benzene derivatives. This compound is known for its stability and resistance to degradation, making it persistent in the environment. It is primarily used in industrial applications, including as an intermediate in the synthesis of other chemicals. However, due to its potential toxicity and environmental impact, it is subject to regulation and monitoring. Safety precautions are necessary when handling this substance, as it may pose health risks through inhalation or skin contact. Overall, 1,2,3,4-tetrachloro-5-methylbenzene exemplifies the characteristics of chlorinated aromatic compounds, including their chemical stability and environmental persistence.
Formula:C7H4Cl4
InChI:InChI=1/C7H4Cl4/c1-3-2-4(8)6(10)7(11)5(3)9/h2H,1H3
SMILES:Cc1cc(c(c(c1Cl)Cl)Cl)Cl
Synonyms:- 2,3,4,5-Tetrachlorotoluene
- Tetrachloromethylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3,4,5-Tetrachlorotoluene
CAS:<p>Applications 2,3,4,5-Tetrachlorotoluene is a tetra-chlorinated derivative of toluene that is often used as a reference standard.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C7H4Cl4Color and Shape:Off-WhiteMolecular weight:229.92

