CAS 1006-41-3
:2-Bromo-4-fluorobenzoic acid
Description:
2-Bromo-4-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and fluorine substituents on the benzene ring. Specifically, the bromine atom is located at the second position and the fluorine atom at the fourth position relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring. The presence of the halogen substituents can influence its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-4-fluorobenzoic acid can participate in electrophilic aromatic substitution reactions and can serve as a building block for more complex organic molecules. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure.
Formula:C7H4BrFO2
InChI:InChI=1/C7H4BrFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11)/p-1
InChI key:InChIKey=RRKPMLZRLKTDQV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C=C(F)C=C1
Synonyms:- 1-(3-Bromo-4-Fluorophenyl)Ethanone
- 2-Bromo-4-Fluorobenzioc Acid
- 2-Bromo-4-Fluorobenzoate
- 2-Bromo-4-Fluorobenzoic
- 2-Bromo-4-fluorobenzoicacid98%
- 4-Fluoro-2-bromobenzoic acid
- Benzoic acid, 2-bromo-4-fluoro-
- Buttpark 18\02-85
- Rarechem Al Bo 1996
- 4-Bromo-5-ethylbenzoic acid
- 2-Bromo-4-fluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-4-fluorobenzoic Acid
CAS:Formula:C7H4BrFO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:219.012-Bromo-4-fluorobenzoic acid, 98%
CAS:<p>2-Bromo-4-fluorobenzoic acid is used in the synthesis of 3-fluoro-8-(methylthio)dibenzo[b,f]thiepin-10(11H)-one, 2-fluoro-8-(methylthio)dibenzo[b,f]thiepin-10(11H)-one, 2-((2-carboxy-5-fluorophenyl)amino)-3-methoxybenzoic acid and 2-bromo-4-fluorobenzamide. It is also used in the preparation of boro</p>Formula:C7H3BrFO2Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:218.00Benzoic acid, 2-bromo-4-fluoro-
CAS:Formula:C7H4BrFO2Purity:98%Color and Shape:SolidMolecular weight:219.0079Ref: IN-DA0002G0
5g25.00€10g29.00€1kg563.00€25g37.00€5kgTo inquire100g86.00€10kgTo inquire500g233.00€2-Bromo-4-fluorobenzoic acid
CAS:2-Bromo-4-fluorobenzoic acidFormula:C7H4BrFO2Purity:98%Color and Shape: white to off-white powderMolecular weight:219.01g/mol2-Bromo-4-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.009




