CymitQuimica logo

CAS 1006-51-5

:

2,3,4,6,7,8-Hexahydro-5(1H)-quinolinone

Description:
2,3,4,6,7,8-Hexahydro-5(1H)-quinolinone, with the CAS number 1006-51-5, is a bicyclic organic compound characterized by its hexahydroquinolinone structure. This compound features a saturated six-membered ring fused to a five-membered nitrogen-containing ring, which contributes to its unique chemical properties. It is typically a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. The presence of the carbonyl group (C=O) in the structure allows for potential reactivity in various chemical reactions, including nucleophilic additions and cyclization processes. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, it may serve as an intermediate in the synthesis of more complex organic molecules. Its solubility can vary in different solvents, and it is generally stable under standard laboratory conditions, although care should be taken to avoid extreme temperatures or reactive environments that could lead to degradation.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c11-9-5-1-4-8-7(9)3-2-6-10-8/h10H,1-6H2
InChI key:InChIKey=FZUXNHFRXMLNHM-UHFFFAOYSA-N
SMILES:O=C1C2=C(CCC1)NCCC2
Synonyms:
  • 2,3,4,6,7,8-Hexahydro-1H-quinolin-5-one
  • 5(1H)-Quinolone, 2,3,4,6,7,8-hexahydro-
  • 1,2,3,4,5,6,7,8-Octahydroquinolin-5-one
  • 2,3,4,6,7,8-Hexahydro-5(1H)-quinolinone
  • 5(1H)-Quinolinone, 2,3,4,6,7,8-hexahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.