CymitQuimica logo

CAS 1006-65-1

:

3-Phenylisoxazole

Description:
3-Phenylisoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a phenyl group at the 3-position of the isoxazole ring contributes to its aromatic properties and influences its reactivity and interactions. This compound typically appears as a crystalline solid and is known for its potential applications in medicinal chemistry, particularly as a scaffold for drug development due to its biological activity. 3-Phenylisoxazole can exhibit various chemical properties, including the ability to participate in electrophilic and nucleophilic reactions, making it versatile in synthetic organic chemistry. Its solubility can vary depending on the solvent, and it may show fluorescence under certain conditions, which can be useful in analytical applications. Overall, 3-Phenylisoxazole is a significant compound in both research and industrial contexts, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C9H7NO
InChI:InChI=1S/C9H7NO/c1-2-4-8(5-3-1)9-6-7-11-10-9/h1-7H
InChI key:InChIKey=ZBRDJMFLJXFIGJ-UHFFFAOYSA-N
SMILES:C=1(C=CON1)C2=CC=CC=C2
Synonyms:
  • 3-Phenyl-1,2-Oxazole
  • Isoxazole, 3-phenyl-
  • 3-Phenylisoxazole
Found 3 products.