CAS 1006-71-9
:1-(4,5-Dihydro-3-thienyl)piperidine
Description:
1-(4,5-Dihydro-3-thienyl)piperidine, with the CAS number 1006-71-9, is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 4,5-dihydro-3-thienyl group indicates that it has a thiophene ring that is partially saturated, contributing to its unique chemical properties. This compound typically exhibits a moderate polarity due to the presence of the nitrogen atom in the piperidine ring and the sulfur atom in the thiophene moiety. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, owing to the functional groups present. Additionally, its structural features suggest potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 1-(4,5-Dihydro-3-thienyl)piperidine is a notable compound in the realm of organic synthesis and pharmacology.
Formula:C9H15NS
InChI:InChI=1S/C9H15NS/c1-2-5-10(6-3-1)9-4-7-11-8-9/h8H,1-7H2
InChI key:InChIKey=GIGHUMDNTFFIKD-UHFFFAOYSA-N
SMILES:C=1(CCSC1)N2CCCCC2
Synonyms:- 1-(4,5-Dihydrothiophen-3-yl)piperidine
- 1-(4,5-Dihydro-3-thienyl)piperidine
- Piperidine, 1-(4,5-dihydro-3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
