CAS 10060-88-5

2-Imino-α-phenyl-3-thiazolidineethanol

Description:

2-Imino-α-phenyl-3-thiazolidineethanol, with the CAS number 10060-88-5, is a chemical compound characterized by its thiazolidine ring structure, which incorporates both nitrogen and sulfur atoms. This compound features an imino group, contributing to its reactivity and potential biological activity. The presence of the phenyl group enhances its aromatic characteristics, which can influence its solubility and interaction with other molecules. Additionally, the hydroxyl group in the ethanol moiety provides sites for hydrogen bonding, potentially affecting its pharmacological properties. 2-Imino-α-phenyl-3-thiazolidineethanol may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of other compounds or as a precursor in organic synthesis. However, specific data regarding its stability, reactivity, and toxicity would require further investigation through experimental studies and literature review. Overall, this compound represents a unique combination of functional groups that may contribute to diverse chemical behavior and applications.

Formula: C₁₁H₁₄N₂OS

InChI: InChI=1S/C11H14N2OS/c12-11-13(6-7-15-11)8-10(14)9-4-2-1-3-5-9/h1-5,10,12,14H,6-8H2

InChI key: InChIKey=UTHQDRBQLOYOFO-UHFFFAOYSA-N

SMILES: C(C(O)C1=CC=CC=C1)N2C(=N)SCC2

Synonyms:

• 2-Imino-3-(2-hydroxy-2-phenylethyl)thiazolidine
• 2-(2-Imino-1,3-thiazolidin-3-yl)-1-phenylethanol
• 2-(2-Iminothiazolidin-3-yl)-1-phenylethanol
• 3-Thiazolidineethanol, 2-imino-α-phenyl-
• 2-Imino-α-phenyl-3-thiazolidineethanol

3-Thiazolidineethanol, 2-imino-α-phenyl-

CAS: 10060-88-5

Formula: C₁₁H₁₄N₂OS

Molecular weight: 222.3067

Ref: IN-DA0002GN