CymitQuimica logo

CAS 100603-32-5

:

Bis(pentamethylcyclopentadienyl)osmium

Description:
Bis(pentamethylcyclopentadienyl)osmium, with the CAS number 100603-32-5, is a coordination compound featuring osmium as the central metal atom coordinated to two pentamethylcyclopentadienyl ligands. This compound is characterized by its unique structure, where the bulky pentamethylcyclopentadienyl ligands provide significant steric hindrance, influencing its reactivity and stability. It typically exhibits a high degree of thermal stability and can be synthesized through various methods involving osmium precursors. The compound is often studied for its potential applications in catalysis, particularly in organic transformations and polymerization processes, due to the favorable electronic properties imparted by the cyclopentadienyl ligands. Additionally, its distinctive electronic structure may allow for interesting interactions in organometallic chemistry. As with many osmium complexes, handling requires caution due to the potential toxicity of osmium compounds. Overall, bis(pentamethylcyclopentadienyl)osmium represents a fascinating area of study within organometallic chemistry, showcasing the interplay between metal centers and organic ligands.
Formula:C20H30Os
InChI:InChI=1/2C10H15.Os/c2*1-6-7(2)9(4)10(5)8(6)3;/h2*1-5H3;/q2*-1;+2
SMILES:CC1=C(C)[C-](C)C(=C1C)C.CC1=C(C)[C-](C)C(=C1C)C.[Os]
Synonyms:
  • Osmium(2+) Bis(1,2,3,4,5-Pentamethylcyclopenta-2,4-Dienide)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.