CAS 1006037-09-7
:2,5-Dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thiophene
Description:
2,5-Dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thiophene, identified by its CAS number 1006037-09-7, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features two methyl groups at the 2 and 5 positions of the thiophene ring, enhancing its hydrophobic characteristics and potentially influencing its electronic properties. The presence of a 4-(trifluoromethyl)phenyl group at the 3 position introduces significant electron-withdrawing effects due to the trifluoromethyl group, which can affect the compound's reactivity and stability. This compound is likely to exhibit interesting physical and chemical properties, such as solubility in organic solvents and potential applications in materials science, particularly in organic electronics or as a building block in synthetic chemistry. Its unique structure may also impart specific optical or electronic characteristics, making it a candidate for further research in various chemical applications.
Formula:C14H13F3S
InChI:InChI=1S/C14H13F3S/c1-9-7-12(10(2)18-9)8-11-3-5-13(6-4-11)14(15,16)17/h3-7H,8H2,1-2H3
InChI key:InChIKey=PXNRSYKOHWZGSK-UHFFFAOYSA-N
SMILES:C(C1=C(C)SC(C)=C1)C2=CC=C(C(F)(F)F)C=C2
Synonyms:- 2,5-Dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]thiophene
- Thiophene, 2,5-dimethyl-3-[[4-(trifluoromethyl)phenyl]methyl]-
- 3-(4-(TRIFLUOROMETHYL)BENZYL)-2,5-DIMETHYLTHIOPHENE
- 2,5-Dimethyl-3-(4-(trifluoromethyl)benzyl)thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
