CAS 100607-02-1
:2-(2,4-DICHLOROPHENOXY)ACETAMIDINE
Description:
2-(2,4-Dichlorophenoxy)acetamidine is a chemical compound characterized by its unique structure, which includes a dichlorophenoxy group attached to an acetamidine moiety. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential reactivity and biological activity. The presence of the dichlorophenyl group suggests that it may have applications in herbicides or as a pharmaceutical agent, given the common use of similar structures in agrochemicals and medicinal chemistry. The acetamidine part of the molecule indicates that it may participate in hydrogen bonding and could act as a weak base. Its solubility and stability can vary depending on the solvent and environmental conditions. Additionally, the compound's safety and handling would require consideration of the toxicity associated with chlorinated aromatic compounds. Overall, 2-(2,4-Dichlorophenoxy)acetamidine is a compound of interest in both research and application, particularly in fields related to chemistry and biochemistry.
Formula:C8H8Cl2N2O
InChI:InChI=1/C8H8Cl2N2O/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H3,11,12)
SMILES:c1cc(c(cc1Cl)Cl)OCC(=N)N
Synonyms:- 2-(2,4-Dichlorophenoxy)ethanimidamide
- Ethanimidamide, 2-(2,4-Dichlorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
