CAS 100607-15-6
:2-(3-bromophenoxy)-N-methyl-ethanamine
Description:
2-(3-bromophenoxy)-N-methyl-ethanamine, with the CAS number 100607-15-6, is an organic compound characterized by its structure, which includes a bromophenyl group, an ether linkage, and a secondary amine. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the bromine atom enhances its electrophilic character, making it a candidate for further chemical modifications or reactions. The N-methyl group suggests that it may exhibit basic properties, allowing it to participate in protonation reactions. Additionally, the ether functionality can influence its polarity and interaction with biological systems, potentially affecting its pharmacological properties. Overall, this compound may be of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of bromine, which can pose health risks.
Formula:C9H12BrNO
InChI:InChI=1/C9H12BrNO/c1-11-5-6-12-9-4-2-3-8(10)7-9/h2-4,7,11H,5-6H2,1H3
SMILES:CNCCOc1cccc(c1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
