CAS 100610-68-2

2-(1,1-DIOXO-1LAMBDA6,4-THIAZINAN-4-YL)-3-PHENYLPROPANOIC ACID

Description:

2-(1,1-Dioxo-1λ6,4-thiazinan-4-yl)-3-phenylpropanoic acid, with CAS number 100610-68-2, is a chemical compound that features a thiazine ring structure, which is characterized by the presence of sulfur and nitrogen atoms in its cyclic framework. This compound typically exhibits properties associated with both acidic and aromatic functionalities due to the presence of the carboxylic acid group and the phenyl group. The thiazine moiety contributes to its potential biological activity, possibly influencing its reactivity and interaction with biological targets. The presence of the dioxo group suggests that it may participate in various chemical reactions, including redox processes. Additionally, the compound's structural complexity may lead to interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are crucial for its application in research and potential therapeutic uses.

Formula: C₁₃H₁₇NO₄S

InChI: InChI=1/C13H17NO4S/c15-13(16)12(10-11-4-2-1-3-5-11)14-6-8-19(17,18)9-7-14/h1-5,12H,6-10H2,(H,15,16)

SMILES: c1ccc(cc1)CC(C(=O)O)N1CCS(=O)(=O)CC1

Synonyms:

• 2-(1,1-Dioxidothiomorpholin-4-Yl)-3-Phenylpropanoic Acid

2-(1,1-Dioxidothiomorpholino)-3-phenylpropanoic acid

CAS: 100610-68-2

Formula: C₁₃H₁₇NO₄S

Color and Shape: Solid

Molecular weight: 283.3434

Ref: IN-DA0002H3