CAS 100622-41-1
:2-[(4-Bromophenyl)methyl]-1H-benzimidazole
Description:
2-[(4-Bromophenyl)methyl]-1H-benzimidazole is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a 4-bromophenyl group attached to the benzimidazole via a methyl linkage contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, owing to the structural features that allow for interactions with biological targets. The bromine substituent can influence the compound's reactivity and stability, as well as its electronic properties, making it a subject of interest in medicinal chemistry. Additionally, the compound's molecular structure allows for various synthetic modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity in biological applications.
Formula:C14H11BrN2
InChI:InChI=1S/C14H11BrN2/c15-11-7-5-10(6-8-11)9-14-16-12-3-1-2-4-13(12)17-14/h1-8H,9H2,(H,16,17)
InChI key:InChIKey=RCFICICMGDCINS-UHFFFAOYSA-N
SMILES:C(C=1NC=2C(N1)=CC=CC2)C3=CC=C(Br)C=C3
Synonyms:- 1H-Benzimidazole, 2-((4-bromophenyl)methyl)-
- 2-[(4-Bromophenyl)methyl]-1H-1,3-benzodiazole
- 2-[(4-Bromophenyl)methyl]-1H-benzimidazole
- Benzimidazole, 2-p-bromobenzyl-
- 2-(4-Bromobenzyl)-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
