CAS 1006319-20-5: 5-(1-Methyl-1H-pyrazol-3-yl)-3-isoxazolecarboxylic acid

Description: 5-(1-Methyl-1H-pyrazol-3-yl)-3-isoxazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrazole and isoxazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of carboxylic acid functionality. The presence of the pyrazole ring suggests potential biological activity, as pyrazole derivatives are often explored for their pharmacological properties. The isoxazole ring contributes to the compound's stability and reactivity, making it a candidate for various chemical reactions. Additionally, the compound may exhibit acidic properties due to the carboxylic acid group, which can participate in hydrogen bonding and influence its interactions in biological systems. Overall, this compound's unique combination of functional groups may lead to interesting applications in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.

Formula: C₈H₇N₃O₃

InChI: InChI=1S/C8H7N3O3/c1-11-3-2-5(9-11)7-4-6(8(12)13)10-14-7/h2-4H,1H3,(H,12,13)

InChI key: InChIKey=AGTZWXOONIEZNL-UHFFFAOYSA-N

SMILES: O=C(O)C1=NOC(=C1)C2=NN(C=C2)C

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-(1-methyl-1H-pyrazol-3-yl)-
• 5-(1-Methyl-1H-pyrazol-3-yl)-3-isoxazolecarboxylic acid

5-(1-methyl-1H-pyrazol-3-yl)isoxazole-3-carboxylic acid

CAS: 1006319-20-5

• Molecular weight: 193.16200256347656

5-(1-Methyl-1H-pyrazol-3-yl)-1,2-oxazole-3-carboxylic acid

CAS: 1006319-20-5

Versatile small molecule scaffold

• Formula: C₈H₇N₃O₃
• Purity: Min. 95%
• Molecular weight: 193.16 g/mol