CAS 1006319-32-9

2-[[(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]sulfonyl]acetic acid

Description:

2-[[(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]sulfonyl]acetic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with chlorine and methyl groups, linked to a sulfonyl group and an acetic acid moiety. This compound typically exhibits properties associated with both acidic and sulfonyl functionalities, making it potentially useful in various chemical reactions and applications. The presence of the pyrazole ring suggests potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The sulfonyl group can enhance solubility and reactivity, while the acetic acid component may contribute to its acidity and potential interactions in biological systems. Overall, this compound's characteristics, including its molecular weight, solubility, and reactivity, would be influenced by the specific arrangement of its functional groups, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₈H₁₁ClN₂O₄S

InChI: InChI=1S/C8H11ClN2O4S/c1-5-8(9)6(2)11(10-5)4-16(14,15)3-7(12)13/h3-4H2,1-2H3,(H,12,13)

InChI key: InChIKey=PSLOTKRMKSLYBG-UHFFFAOYSA-N

SMILES: C(S(CC(O)=O)(=O)=O)N1C(C)=C(Cl)C(C)=N1

Synonyms:

• Acetic acid, 2-[[(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]sulfonyl]-
• 2-[[(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl]sulfonyl]acetic acid

2-[(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methanesulfonyl]acetic acid

CAS: 1006319-32-9

Versatile small molecule scaffold

Formula: C₈H₁₁ClN₂O₄S

Purity: Min. 95%

Molecular weight: 266.7 g/mol

Ref: 3D-GQB31932