CAS 1006319-34-1: Methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate
Description:Methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a cyclopentyl group, contributing to its hydrophobic properties, and a carboxylate functional group, which enhances its reactivity and solubility in polar solvents. The presence of the methyl ester group indicates that it can undergo hydrolysis to form the corresponding acid. Methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate is of interest in various fields, including medicinal chemistry, due to its potential biological activity. Its structural features may influence its interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-14-10(13)9-6-7-12(11-9)8-4-2-3-5-8/h6-8H,2-5H2,1H3
InChI key:InChIKey=MEQPGDNZYFDJAH-UHFFFAOYSA-N
SMILES:O=C(OC)C1=NN(C=C1)C2CCCC2
- Synonyms:
- 1H-Pyrazole-3-carboxylic acid, 1-cyclopentyl-, methyl ester
- Methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate REF: 3D-GQB31934CAS: 1006319-34-1 | Min. 95% | 228.00 €~2,029.00 € | Mon 14 Apr 25 |
![]() | methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate REF: 10-F427140CAS: 1006319-34-1 | - - - | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Methyl 1-cyclopentyl-1H-pyrazole-3-carboxylate
Ref: 3D-GQB31934
50mg | 595.00 € | ||
500mg | 1,640.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F427140
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |