CAS 1006319-92-1
:α,3,5-Trimethyl-1H-pyrazole-1-propanenitrile
Description:
α,3,5-Trimethyl-1H-pyrazole-1-propanenitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features three methyl groups attached to the pyrazole ring, contributing to its hydrophobic properties and potentially influencing its reactivity and solubility. The presence of a propanenitrile group indicates that it contains a cyano functional group (-C≡N), which can enhance its reactivity and may allow for various chemical transformations. This compound is likely to exhibit moderate stability under standard conditions but may be sensitive to strong acids or bases. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of multiple functional groups may allow for diverse interactions in biological systems or chemical reactions. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C9H13N3
InChI:InChI=1S/C9H13N3/c1-7(5-10)6-12-9(3)4-8(2)11-12/h4,7H,6H2,1-3H3
InChI key:InChIKey=SBJZRUMUZPIDAU-UHFFFAOYSA-N
SMILES:C(C(C#N)C)N1N=C(C)C=C1C
Synonyms:- α,3,5-Trimethyl-1H-pyrazole-1-propanenitrile
- 1H-Pyrazole-1-propanenitrile, α,3,5-trimethyl-
- AKOS B028611
- ART-CHEM-BB B028611
- AKOS PAO-0006
- 3-(3,5-dimethyl-1H-pyrazol-1-yl)-2-methylpropanenitrile
- 3-(3,5-DIMETHYL-PYRAZOL-1-YL)-2-METHYL-PROPIONITRILE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.