CAS 1006319-96-5
:α,3-Dimethyl-1H-pyrazole-1-propanethioamide
Description:
α,3-Dimethyl-1H-pyrazole-1-propanethioamide is a chemical compound characterized by its unique pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a propanethioamide functional group, indicating the presence of a thiol (sulfur-containing) moiety attached to a propyl chain. The presence of two methyl groups at the 3 and 1 positions of the pyrazole ring contributes to its steric and electronic properties, potentially influencing its reactivity and interactions with other molecules. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 1006319-96-5, allows for precise identification in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, α,3-Dimethyl-1H-pyrazole-1-propanethioamide represents a class of compounds that may have applications in medicinal chemistry and agrochemicals.
Formula:C8H13N3S
InChI:InChI=1S/C8H13N3S/c1-6(8(9)12)5-11-4-3-7(2)10-11/h3-4,6H,5H2,1-2H3,(H2,9,12)
InChI key:InChIKey=GKVVATWWOYIQOK-UHFFFAOYSA-N
SMILES:C(C(C(N)=S)C)N1C=CC(C)=N1
Synonyms:- α,3-Dimethyl-1H-pyrazole-1-propanethioamide
- 1H-Pyrazole-1-propanethioamide, α,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.