CAS 1006319-97-6

Ethyl 5-methyl-1H-pyrazole-1-propanoate

Description:

Ethyl 5-methyl-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the 5-methyl substituent on the pyrazole ring enhances its steric properties and may influence its biological activity. Ethyl 5-methyl-1H-pyrazole-1-propanoate is typically synthesized through esterification reactions involving pyrazole derivatives and propanoic acid or its derivatives. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, this compound represents a unique structure within the realm of pyrazole derivatives, with potential implications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-3-13-9(12)5-7-11-8(2)4-6-10-11/h4,6H,3,5,7H2,1-2H3

InChI key: InChIKey=KTRCUZDDTBPYES-UHFFFAOYSA-N

SMILES: C(CC(OCC)=O)N1C(C)=CC=N1

Synonyms:

• Ethyl 5-methyl-1H-pyrazole-1-propanoate
• 1H-Pyrazole-1-propanoic acid, 5-methyl-, ethyl ester