CymitQuimica logo

CAS 1006320-27-9

:

5-[[4-Bromo-3,5-bis(difluoromethyl)-1H-pyrazol-1-yl]methyl]-2-furancarboxaldehyde

Description:
5-[[4-Bromo-3,5-bis(difluoromethyl)-1H-pyrazol-1-yl]methyl]-2-furancarboxaldehyde is a complex organic compound characterized by its unique structural features, which include a furan ring and a pyrazole moiety. The presence of a bromine atom and difluoromethyl groups contributes to its reactivity and potential applications in medicinal chemistry and agrochemicals. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets due to its functional groups. Its aldehyde functional group suggests potential for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Additionally, the compound's molecular structure may influence its physical properties, such as melting point and boiling point, as well as its stability under various conditions. Overall, this substance is of interest for research and development in fields that explore novel chemical entities with potential biological activity.
Formula:C11H7BrF4N2O2
InChI:InChI=1S/C11H7BrF4N2O2/c12-7-8(10(13)14)17-18(9(7)11(15)16)3-5-1-2-6(4-19)20-5/h1-2,4,10-11H,3H2
InChI key:InChIKey=AOVVTIGTPDNPQI-UHFFFAOYSA-N
SMILES:C(N1C(C(F)F)=C(Br)C(C(F)F)=N1)C=2OC(C=O)=CC2
Synonyms:
  • 5-[[4-Bromo-3,5-bis(difluoromethyl)-1H-pyrazol-1-yl]methyl]-2-furancarboxaldehyde
  • 2-Furancarboxaldehyde, 5-[[4-bromo-3,5-bis(difluoromethyl)-1H-pyrazol-1-yl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.