CAS 1006328-51-3
:N<sup>1</sup>-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1,2-ethanediamine
Description:
N1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1,2-ethanediamine is an organic compound characterized by its unique structure, which includes a pyrazole ring and an ethylenediamine moiety. The presence of the pyrazole ring contributes to its potential biological activity, as pyrazoles are often associated with various pharmacological properties. This compound features two amine groups, which can participate in hydrogen bonding and may influence its solubility and reactivity. The ethyl and methyl substituents on the pyrazole ring can affect the compound's lipophilicity and steric properties, potentially impacting its interaction with biological targets. Additionally, the compound may exhibit basicity due to the amine functionalities, which can play a role in its behavior in different pH environments. Overall, the combination of these structural features suggests that N1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1,2-ethanediamine could be of interest in medicinal chemistry and related fields.
Formula:C9H18N4
InChI:InChI=1S/C9H18N4/c1-3-13-7-9(8(2)12-13)6-11-5-4-10/h7,11H,3-6,10H2,1-2H3
InChI key:InChIKey=QLOOCPDYZDPLJK-UHFFFAOYSA-N
SMILES:C(NCCN)C=1C(C)=NN(CC)C1
Synonyms:- 1,2-Ethanediamine, N1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-
- N1-[(1-Ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1,2-ethanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.