CymitQuimica logo

CAS 1006328-61-5

:

3-(Dimethylamino)-1-(1-methyl-1H-pyrazol-4-yl)-2-propen-1-one

Description:
3-(Dimethylamino)-1-(1-methyl-1H-pyrazol-4-yl)-2-propen-1-one, identified by its CAS number 1006328-61-5, is an organic compound characterized by its unique structural features, including a dimethylamino group and a pyrazole moiety. This compound typically exhibits properties associated with both ketones and alkenes, such as reactivity in nucleophilic addition and potential for polymerization due to the presence of the double bond. It may display moderate to high solubility in polar organic solvents, influenced by the dimethylamino group, which can engage in hydrogen bonding. The pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability can be affected by environmental factors such as pH and temperature. Overall, its unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c1-11(2)5-4-9(13)8-6-10-12(3)7-8/h4-7H,1-3H3
InChI key:InChIKey=QMWPEMVHSGALOP-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CN(C)N=C1
Synonyms:
  • 2-Propen-1-one, 3-(dimethylamino)-1-(1-methyl-1H-pyrazol-4-yl)-
  • 3-(Dimethylamino)-1-(1-methyl-1H-pyrazol-4-yl)-2-propen-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.