CymitQuimica logo

CAS 1006333-99-8

:

1-[[3-(Trifluoromethyl)phenoxy]methyl]-1H-pyrazol-4-amine

Description:
1-[[3-(Trifluoromethyl)phenoxy]methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a trifluoromethyl-substituted phenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amine functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The presence of the pyrazole moiety is often linked to various biological activities, including anti-inflammatory and analgesic effects. Additionally, the compound may exhibit solubility in organic solvents, which is common for many pyrazole derivatives. Its specific applications and behavior in chemical reactions would depend on the context of its use, such as in medicinal chemistry or agrochemical formulations. Overall, this compound represents a class of substances that can be tailored for specific interactions in biological systems or materials science.
Formula:C11H10F3N3O
InChI:InChI=1S/C11H10F3N3O/c12-11(13,14)8-2-1-3-10(4-8)18-7-17-6-9(15)5-16-17/h1-6H,7,15H2
InChI key:InChIKey=RFDOOPWKQYQPLF-UHFFFAOYSA-N
SMILES:O(CN1N=CC(N)=C1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • 1-[[3-(Trifluoromethyl)phenoxy]methyl]-1H-pyrazol-4-amine
  • 1H-Pyrazol-4-amine, 1-[[3-(trifluoromethyl)phenoxy]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.