CAS 1006334-07-1
:4-Chloro-α-methyl-1H-pyrazole-1-propanethioamide
Description:
4-Chloro-α-methyl-1H-pyrazole-1-propanethioamide is a chemical compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two adjacent nitrogen atoms. The presence of a chloro substituent at the fourth position of the pyrazole ring contributes to its reactivity and potential biological activity. The α-methyl group enhances the steric properties of the molecule, while the propanethioamide functional group introduces a thiolamide moiety, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. As with many chemical substances, safety and handling precautions should be observed due to the presence of chlorine and sulfur in its structure, which may pose hazards in certain contexts.
Formula:C7H10ClN3S
InChI:InChI=1S/C7H10ClN3S/c1-5(7(9)12)3-11-4-6(8)2-10-11/h2,4-5H,3H2,1H3,(H2,9,12)
InChI key:InChIKey=XHACJEDCAVIQQO-UHFFFAOYSA-N
SMILES:C(C(C(N)=S)C)N1N=CC(Cl)=C1
Synonyms:- 4-Chloro-α-methyl-1H-pyrazole-1-propanethioamide
- 1H-Pyrazole-1-propanethioamide, 4-chloro-α-methyl-
- 3-(4-chloro-1H-pyrazol-1-yl)-2-methylpropanethioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.