CAS 1006334-09-3

3-Methyl-1H-pyrazole-1-propanol

Description:

3-Methyl-1H-pyrazole-1-propanol is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a hydroxyl group (-OH) attached to a propanol chain, contributing to its properties as an alcohol. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methyl group enhances its hydrophobic characteristics, while the hydroxyl group increases its polarity, allowing for potential hydrogen bonding. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. It may exhibit properties such as antimicrobial or antifungal activity, making it a candidate for further research in medicinal chemistry. Additionally, its unique structure allows for potential applications in the synthesis of other chemical compounds. As with many organic substances, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₇H₁₂N₂O

InChI: InChI=1S/C7H12N2O/c1-7-3-5-9(8-7)4-2-6-10/h3,5,10H,2,4,6H2,1H3

InChI key: InChIKey=KSFGYOOKNPKWMY-UHFFFAOYSA-N

SMILES: C(CCO)N1N=C(C)C=C1

Synonyms:

• 3-Methyl-1H-pyrazole-1-propanol
• 1H-Pyrazole-1-propanol, 3-methyl-
• 3-(3-methyl-1H-pyrazol-1-yl)propan-1-ol