CAS 1006334-14-0

1-(4-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid

Description:

1-(4-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a bi-pyrazole framework and a carboxylic acid functional group. The presence of a fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. The compound's molecular structure indicates it may exhibit interesting properties such as potential anti-inflammatory or anti-cancer activities, which are common in compounds with similar frameworks. Additionally, the dimethyl substitution can affect the compound's solubility and reactivity. Its carboxylic acid group may also participate in hydrogen bonding, influencing its interactions in biological systems. Overall, this compound's unique structural features make it a subject of interest for further research in various chemical and biological applications.

Formula: C₁₅H₁₃FN₄O₂

InChI: InChI=1S/C15H13FN4O2/c1-9-12(7-19(2)17-9)14-13(15(21)22)8-20(18-14)11-5-3-10(16)4-6-11/h3-8H,1-2H3,(H,21,22)

InChI key: InChIKey=CAZYVMXZPIHFIQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=NN(C1)C2=CC=C(F)C=C2)C3=CN(C)N=C3C

Synonyms:

• 1-(4-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid
• [3,4′-Bi-1H-pyrazole]-4-carboxylic acid, 1-(4-fluorophenyl)-1′,3′-dimethyl-

1-(4-Fluorophenyl)-1',3'-dimethyl-1H,1'H-3,4'-bipyrazole-4-carboxylic acid

CAS: 1006334-14-0

1-(4-Fluorophenyl)-1',3'-dimethyl-1H,1'H-3,4'-bipyrazole-4-carboxylic acid

Purity: ≥95%

Molecular weight: 300.29g/mol

Ref: 54-PC410388

3-(1,3-Dimethyl-1H-pyrazol-4-yl)-1-(4-fluorophenyl)-1H-pyrazole-4-carboxylic acid

CAS: 1006334-14-0

Versatile small molecule scaffold

Formula: C₁₅H₁₃FN₄O₂

Purity: Min. 95%

Molecular weight: 300.29 g/mol

Ref: 3D-GQB33414