CymitQuimica logo

CAS 1006334-15-1

:

1′-Ethyl-3′,5′-dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde

Description:
1′-Ethyl-3′,5′-dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde is a complex organic compound characterized by its unique structure, which includes a bi-pyrazole framework and an aldehyde functional group. This compound typically exhibits properties associated with both pyrazole derivatives and aldehydes, such as potential reactivity in condensation reactions and the ability to participate in nucleophilic attacks due to the electrophilic nature of the carbonyl group. The presence of ethyl and methyl substituents contributes to its lipophilicity, which may influence its solubility in organic solvents. Additionally, the phenyl group can enhance its stability and may provide aromatic characteristics, affecting its electronic properties. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrazole derivatives. However, specific biological activities and applications would require further investigation and validation through experimental studies.
Formula:C17H18N4O
InChI:InChI=1S/C17H18N4O/c1-4-20-13(3)16(12(2)18-20)17-14(11-22)10-21(19-17)15-8-6-5-7-9-15/h5-11H,4H2,1-3H3
InChI key:InChIKey=GFBWEVLGJPXQKO-UHFFFAOYSA-N
SMILES:C(=O)C=1C(=NN(C1)C2=CC=CC=C2)C3=C(C)N(CC)N=C3C
Synonyms:
  • 1′-Ethyl-3′,5′-dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde
  • [3,4′-Bi-1H-pyrazole]-4-carboxaldehyde, 1′-ethyl-3′,5′-dimethyl-1-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.