CAS 1006334-18-4

5-(1H-Pyrazol-1-ylmethyl)-2-thiophenecarboxylic acid

Description:

5-(1H-Pyrazol-1-ylmethyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes a pyrazole ring and a thiophene moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as potential acidity due to the carboxylic group, which can donate protons in solution. The presence of the pyrazole and thiophene rings may contribute to its biological activity, making it of interest in medicinal chemistry. The compound is likely to be soluble in polar organic solvents and may exhibit moderate stability under standard conditions. Its molecular interactions can be influenced by the functional groups present, allowing for potential applications in drug development or as a ligand in coordination chemistry. Additionally, the compound's reactivity may be explored in various synthetic pathways, particularly in the formation of derivatives or in coupling reactions. Overall, 5-(1H-Pyrazol-1-ylmethyl)-2-thiophenecarboxylic acid represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₉H₈N₂O₂S

InChI: InChI=1S/C9H8N2O2S/c12-9(13)8-3-2-7(14-8)6-11-5-1-4-10-11/h1-5H,6H2,(H,12,13)

InChI key: InChIKey=SHJNJZMFMCCRON-UHFFFAOYSA-N

SMILES: C(C=1SC(C(O)=O)=CC1)N2C=CC=N2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-(1H-pyrazol-1-ylmethyl)-
• 5-(1H-Pyrazol-1-ylmethyl)-2-thiophenecarboxylic acid