CAS 1006334-20-8

1-(4-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde

Description:

1-(4-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a bi-pyrazole framework and a fluorophenyl group. This compound features a carboxaldehyde functional group, which is indicative of its potential reactivity, particularly in condensation reactions. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. The dimethyl substitution on the pyrazole moiety may affect steric hindrance and solubility. This compound is of interest in medicinal chemistry and material science due to its unique structural features, which may impart specific pharmacological properties or facilitate interactions with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be evaluated for various applications, including as a potential drug candidate or in the development of novel materials.

Formula: C₁₅H₁₃FN₄O

InChI: InChI=1S/C15H13FN4O/c1-10-14(8-19(2)17-10)15-11(9-21)7-20(18-15)13-5-3-12(16)4-6-13/h3-9H,1-2H3

InChI key: InChIKey=YRRPKLKDUQNPOM-UHFFFAOYSA-N

SMILES: C(=O)C=1C(=NN(C1)C2=CC=C(F)C=C2)C=3C(C)=NN(C)C3

Synonyms:

• [3,4′-Bi-1H-pyrazole]-4-carboxaldehyde, 1-(4-fluorophenyl)-1′,3′-dimethyl-
• 1-(4-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde

1-(4-Fluorophenyl)-1',3'-dimethyl-1H,1'H-3,4'-bipyrazole-4-carbaldehyde

CAS: 1006334-20-8

Versatile small molecule scaffold

Formula: C₁₅H₁₃FN₄O

Purity: Min. 95%

Molecular weight: 284.29 g/mol

Ref: 3D-GQB33420