CAS 1006334-22-0

1′-Methyl-3,5′-bi-1H-pyrazole

Description:

1′-Methyl-3,5′-bi-1H-pyrazole, identified by its CAS number 1006334-22-0, is a chemical compound characterized by its unique pyrazole structure, which consists of two pyrazole rings connected by a methylene bridge. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. It may display biological activity, making it of interest in medicinal chemistry and agricultural applications. The presence of the methyl group at the 1′ position can influence its reactivity and interaction with other molecules. Additionally, 1′-Methyl-3,5′-bi-1H-pyrazole may participate in various chemical reactions, including substitution and condensation reactions, due to the presence of nitrogen atoms in its structure, which can act as nucleophiles. Its potential applications could extend to the development of pharmaceuticals or agrochemicals, depending on its specific biological properties and reactivity. As with any chemical substance, proper handling and safety protocols should be observed to mitigate any risks associated with its use.

Formula: C₇H₈N₄

InChI: InChI=1S/C7H8N4/c1-11-7(3-5-9-11)6-2-4-8-10-6/h2-5H,1H3,(H,8,10)

InChI key: InChIKey=SMCLTXSMCNJKEU-UHFFFAOYSA-N

SMILES: CN1C(=CC=N1)C=2C=CNN2

Synonyms:

• 1-Methyl-5-(1H-pyrazol-3-yl)-1H-pyrazole
• 3,5′-Bi-1H-pyrazole, 1′-methyl-
• 1′-Methyl-3,5′-bi-1H-pyrazole
• 1-Methyl-5-(1H-pyrazol-5-yl)pyrazole
• 2′-Methyl-1H,2′H-3,3′-bipyrazole