CAS 1006334-37-7

4-Chloro-1-(2,2-diethoxyethyl)-1H-pyrazole

Description:

4-Chloro-1-(2,2-diethoxyethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and a diethoxyethyl group at the 1-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, which makes it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The diethoxyethyl group enhances its lipophilicity, potentially influencing its biological activity and interaction with other molecules. As with many halogenated compounds, it may exhibit specific reactivity patterns, such as nucleophilic substitution or electrophilic aromatic substitution. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-1-(2,2-diethoxyethyl)-1H-pyrazole is a versatile compound with applications in synthetic organic chemistry.

Formula: C₉H₁₅ClN₂O₂

InChI: InChI=1S/C9H15ClN2O2/c1-3-13-9(14-4-2)7-12-6-8(10)5-11-12/h5-6,9H,3-4,7H2,1-2H3

InChI key: InChIKey=DKMQTCOFRGHZOW-UHFFFAOYSA-N

SMILES: C(C(OCC)OCC)N1N=CC(Cl)=C1

Synonyms:

• 1H-Pyrazole, 4-chloro-1-(2,2-diethoxyethyl)-
• 4-Chloro-1-(2,2-diethoxyethyl)-1H-pyrazole