CAS 1006348-49-7
:4-Chloro-3,5-dimethyl-1H-pyrazole-1-propanol
Description:
4-Chloro-3,5-dimethyl-1H-pyrazole-1-propanol is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 4-position and two methyl groups at the 3 and 5 positions of the pyrazole ring, along with a propanol group at the 1-position. The presence of the chloro group contributes to its reactivity and potential applications in various chemical reactions. The hydroxyl group in the propanol moiety enhances its solubility in polar solvents and may influence its biological activity. This compound is of interest in medicinal chemistry and agricultural applications, particularly as a potential herbicide or fungicide. Its unique structure allows for various modifications, which can lead to derivatives with different properties and activities. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C8H13ClN2O
InChI:InChI=1S/C8H13ClN2O/c1-6-8(9)7(2)11(10-6)4-3-5-12/h12H,3-5H2,1-2H3
InChI key:InChIKey=NKCWMHKGZVSXPB-UHFFFAOYSA-N
SMILES:C(CCO)N1C(C)=C(Cl)C(C)=N1
Synonyms:- 4-Chloro-3,5-dimethyl-1H-pyrazole-1-propanol
- 1H-Pyrazole-1-propanol, 4-chloro-3,5-dimethyl-
- 3-(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.