CAS 1006348-55-5
:1-(2-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid
Description:
1-(2-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a bi-pyrazole framework and a carboxylic acid functional group. The presence of the 2-fluorophenyl group introduces a fluorine atom, which can influence the compound's electronic properties and reactivity. This compound is likely to exhibit moderate to high solubility in polar solvents due to the carboxylic acid group, which can participate in hydrogen bonding. Its unique structure may confer specific biological activities, making it of interest in pharmaceutical research. The compound's molecular interactions, stability, and potential applications can be influenced by the arrangement of its functional groups and the presence of the fluorine atom. As with many pyrazole derivatives, it may exhibit properties such as anti-inflammatory or analgesic effects, although specific biological data would be necessary to confirm such activities. Overall, this compound represents a class of heterocyclic compounds with diverse applications in medicinal chemistry.
Formula:C15H13FN4O2
InChI:InChI=1S/C15H13FN4O2/c1-9-10(7-19(2)17-9)14-11(15(21)22)8-20(18-14)13-6-4-3-5-12(13)16/h3-8H,1-2H3,(H,21,22)
InChI key:InChIKey=SWZXIGMZOAGERE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=NN(C1)C2=C(F)C=CC=C2)C=3C(C)=NN(C)C3
Synonyms:- 1-(2-Fluorophenyl)-1′,3′-dimethyl[3,4′-bi-1H-pyrazole]-4-carboxylic acid
- [3,4′-Bi-1H-pyrazole]-4-carboxylic acid, 1-(2-fluorophenyl)-1′,3′-dimethyl-
- [3,4'-Bi-1H-pyrazole]-4-carboxylic acid, 1-(2-fluorophenyl)-1',3'-dimethyl-
- 1-(2-fluorophenyl)-1,3-dimethyl-1H,1H-3,4-bipyrazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.