CAS 1006348-68-0: 4-Methyl-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-2-thiazolamine

Description: 4-Methyl-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-2-thiazolamine is a chemical compound characterized by its complex structure, which includes a thiazole ring, a pyrazole moiety, and a trifluoromethyl group. The presence of the thiazole and pyrazole rings suggests potential biological activity, as these structures are often found in pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or herbicidal activities, making it of interest in medicinal chemistry and agricultural applications. Its molecular structure contributes to its stability and solubility characteristics, which are crucial for its efficacy in various applications. Additionally, the presence of multiple functional groups allows for potential modifications that can lead to the development of derivatives with enhanced properties. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₈H₇F₃N₄S

InChI: InChI=1S/C8H7F3N4S/c1-4-6(16-7(12)13-4)15-3-2-5(14-15)8(9,10)11/h2-3H,1H3,(H2,12,13)

InChI key: InChIKey=JGGXTJSNPHMHSG-UHFFFAOYSA-N

SMILES: FC(F)(F)C1=NN(C=C1)C=2SC(=NC2C)N

Synonyms:

• 2-Thiazolamine, 4-methyl-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-
• 4-Methyl-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-2-thiazolamine

4-Methyl-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-1,3-thiazol-2-amine

CAS: 1006348-68-0

• Molecular weight: 248.23g/mol

4-Methyl-5-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-1,3-thiazol-2-amine

CAS: 1006348-68-0

Versatile small molecule scaffold

• Formula: C₈H₇F₃N₄S
• Purity: Min. 95%
• Molecular weight: 248.23 g/mol

4-Methyl-5-(3-trifluoromethyl-pyrazol-1-yl)-thiazol-2-ylamine

CAS: 1006348-68-0

• Molecular weight: 248.22999572753906