CAS 1006348-72-6

4-Chloro-1-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine

Description:

4-Chloro-1-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its complex structure, which includes multiple pyrazole rings and a chloro substituent. This compound features a chloro group at the 4-position of one pyrazole ring and a dimethyl-substituted pyrazole moiety linked through a methylene bridge. It is typically classified as an organic compound and may exhibit properties such as moderate solubility in polar solvents due to the presence of nitrogen atoms in its structure. The presence of the pyrazole rings suggests potential biological activity, making it of interest in pharmaceutical research. Its molecular structure may allow for interactions with various biological targets, potentially leading to applications in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole rings, which may affect its synthesis and functional properties. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₉H₁₂ClN₅

InChI: InChI=1S/C9H12ClN5/c1-6-7(3-12-14(6)2)4-15-5-8(10)9(11)13-15/h3,5H,4H2,1-2H3,(H2,11,13)

InChI key: InChIKey=VSUQQSJMBFWALA-UHFFFAOYSA-N

SMILES: C(C1=C(C)N(C)N=C1)N2C=C(Cl)C(N)=N2

Synonyms:

• 4-Chloro-1-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 4-chloro-1-[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]-