CAS 1006348-73-7

3-Amino-5-methyl-1H-pyrazole-1-acetic acid

Description:

3-Amino-5-methyl-1H-pyrazole-1-acetic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as an acid and a base. The presence of the methyl group at the 5-position of the pyrazole ring influences its solubility and reactivity. It is often studied for its biological activity, particularly in the context of pharmaceuticals, where it may exhibit properties such as anti-inflammatory or analgesic effects. The compound's molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its CAS number, 1006348-73-7, serves as a unique identifier for regulatory and research purposes. Overall, 3-Amino-5-methyl-1H-pyrazole-1-acetic acid is a versatile compound with potential applications in drug development and other chemical research fields.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-4-2-5(7)8-9(4)3-6(10)11/h2H,3H2,1H3,(H2,7,8)(H,10,11)

InChI key: InChIKey=OBTVEFHNTMGJFY-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(N)C=C1C

Synonyms:

• 1H-Pyrazole-1-acetic acid, 3-amino-5-methyl-
• 3-Amino-5-methyl-1H-pyrazole-1-acetic acid