CAS 1006348-89-5

2-(4-Bromo-1H-pyrazol-1-yl)-1-(1-piperazinyl)ethanone

Description:

2-(4-Bromo-1H-pyrazol-1-yl)-1-(1-piperazinyl)ethanone is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a piperazine moiety. The presence of the bromine atom on the pyrazole ring contributes to its reactivity and potential biological activity. This compound features an ethanone functional group, indicating it has ketone characteristics, which can influence its chemical behavior and interactions. The piperazine ring is known for its ability to form hydrogen bonds and participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmacology, particularly in the development of agents targeting neurological or other disorders. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine substituent and the piperazine group, which may affect its bioavailability and therapeutic efficacy. Overall, this compound represents a unique combination of structural features that may confer specific biological properties.

Formula: C₉H₁₃BrN₄O

InChI: InChI=1S/C9H13BrN4O/c10-8-5-12-14(6-8)7-9(15)13-3-1-11-2-4-13/h5-6,11H,1-4,7H2

InChI key: InChIKey=WJKNNFVIALXSHN-UHFFFAOYSA-N

SMILES: C(C(=O)N1CCNCC1)N2N=CC(Br)=C2

Synonyms:

• 1-[(4-Bromo-1H-pyrazol-1-yl)acetyl]piperazine
• Ethanone, 2-(4-bromo-1H-pyrazol-1-yl)-1-(1-piperazinyl)-
• 2-(4-Bromo-1H-pyrazol-1-yl)-1-(1-piperazinyl)ethanone
• 2-(4-Bromo-1H-pyrazol-1-yl)-1-(piperazin-1-yl)-ethanone
• 2-(4-Bromo-1H-pyrazol-1-yl)-1-(piperazin-1-yl)ethan-1-one