CAS 1006349-05-8
:Ethyl 1-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-4-piperidinecarboxylate
Description:
Ethyl 1-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-4-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrazole moiety. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including moderate polarity due to the presence of ester and amine functional groups. It is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions. The presence of the piperidine ring suggests potential basicity, while the pyrazole component may contribute to its biological activity, possibly influencing its pharmacological properties. The compound's solubility is expected to vary in different solvents, often being more soluble in organic solvents than in water. Additionally, its structure may allow for various chemical reactions, making it a candidate for further synthetic modifications in medicinal chemistry. Overall, this compound's unique structural features may lend it potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require empirical investigation.
Formula:C15H25N3O2
InChI:InChI=1S/C15H25N3O2/c1-4-18-12(3)14(10-16-18)11-17-8-6-13(7-9-17)15(19)20-5-2/h10,13H,4-9,11H2,1-3H3
InChI key:InChIKey=VMYCGMISVOIRFO-UHFFFAOYSA-N
SMILES:C(C1=C(C)N(CC)N=C1)N2CCC(C(OCC)=O)CC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-, ethyl ester
- Ethyl 1-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)methyl]-4-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.