
CAS 1006380-19-3
:1-(1,1-Dimethylethyl)-4-piperidinecarbonitrile
Description:
1-(1,1-Dimethylethyl)-4-piperidinecarbonitrile, identified by its CAS number 1006380-19-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a cyano group (-C≡N) at the 4-position of the piperidine ring contributes to its reactivity and potential applications in organic synthesis. The tert-butyl group (1,1-dimethylethyl) at the 1-position provides steric hindrance, influencing the compound's physical and chemical properties, such as solubility and boiling point. This compound is typically a solid at room temperature and may exhibit moderate polarity due to the functional groups present. Its unique structure makes it of interest in medicinal chemistry and material science, where it may serve as a building block for more complex molecules or as a potential pharmacophore. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C10H18N2
InChI:InChI=1S/C10H18N2/c1-10(2,3)12-6-4-9(8-11)5-7-12/h9H,4-7H2,1-3H3
InChI key:InChIKey=KOZLWPMCMZBSDU-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1CCC(C#N)CC1
Synonyms:- 1-tert-Butylpiperidine-4-carbonitrile
- 4-Piperidinecarbonitrile, 1-(1,1-dimethylethyl)-
- 1-(1,1-Dimethylethyl)-4-piperidinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.