CymitQuimica logo

CAS 1006435-99-9

:

3-[(5-Methyl-3-nitro-1H-pyrazol-1-yl)methoxy]benzaldehyde

Description:
3-[(5-Methyl-3-nitro-1H-pyrazol-1-yl)methoxy]benzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety and a pyrazole ring. The presence of a methoxy group linked to the benzaldehyde enhances its reactivity and solubility in organic solvents. The nitro group on the pyrazole ring contributes to its electron-withdrawing properties, potentially influencing its chemical reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 3-[(5-Methyl-3-nitro-1H-pyrazol-1-yl)methoxy]benzaldehyde is a versatile compound with unique characteristics that warrant further investigation in various chemical and biological contexts.
Formula:C12H11N3O4
InChI:InChI=1S/C12H11N3O4/c1-9-5-12(15(17)18)13-14(9)8-19-11-4-2-3-10(6-11)7-16/h2-7H,8H2,1H3
InChI key:InChIKey=KFSLTEZAUFNCNE-UHFFFAOYSA-N
SMILES:C(OC1=CC(C=O)=CC=C1)N2N=C(N(=O)=O)C=C2C
Synonyms:
  • 3-[(5-Methyl-3-nitro-1H-pyrazol-1-yl)methoxy]benzaldehyde
  • Benzaldehyde, 3-[(5-methyl-3-nitro-1H-pyrazol-1-yl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.