CAS 100644-65-3
:4-CHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDIN-6-AMINE
Description:
4-Chloro-1H-pyrazolo[3,4-d]pyrimidin-6-amine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which consists of a fused pyrazole and pyrimidine ring system. The presence of a chlorine atom at the 4-position and an amino group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is often studied for its potential applications in medicinal chemistry, particularly as a scaffold for developing kinase inhibitors or other therapeutic agents. The compound's unique structure allows for various substitution patterns, which can influence its pharmacological properties. Additionally, its molecular interactions can be explored through various analytical techniques, including spectroscopy and crystallography, to understand its behavior in biological systems. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C5H4ClN5
InChI:InChI=1/C5H4ClN5/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H,(H3,7,8,9,10,11)
SMILES:c1c2c(Cl)nc(=N)nc2[nH][nH]1
Synonyms:- 1H-pyrazolo[3,4-d]pyrimidin-6-amine, 4-chloro-
- T56 Bmn Gn Inj Fg Hz
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1H-Pyrazolo[3,4-d]pyrimidin-6-amine, 4-chloro-
CAS:Formula:C5H4ClN5Purity:95%Color and Shape:SolidMolecular weight:169.57186-Amino-4-chloro-1H-pyrazolo[3,4-d]pyrimidine
CAS:6-Amino-4-chloro-1H-pyrazolo[3,4-d]pyrimidinePurity:98%Color and Shape:Off-White SolidMolecular weight:169.57176g/mol4-Chloro-1H-pyrazolo[3,4-d]pyrimidin-6-ylamine
CAS:Formula:C5H4ClN5Purity:95.0%Color and Shape:SolidMolecular weight:169.576-Amino-4-chloropyrazolo[3,4-d]pyrimidine
CAS:6-Amino-4-chloropyrazolo[3,4-d]pyrimidine bolongs toIntermediates and Building Blocks - Nucleoside Base; Multi-functional; Heterocyclic Compounds - Purine;Formula:C5H4ClN5Color and Shape:SolidMolecular weight:169.57Ref: TM-TNU1018
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquireC4-Chloro-1H-pyrazolo[3,4-d]pyrimidin-6-amine
CAS:Formula:C5H4ClN5Color and Shape:NeatMolecular weight:169.574-Chloro-1H-pyrazolo[3,4-d]pyrimidin-6-amine
CAS:Purity:95%Color and Shape:SolidMolecular weight:169.5700073





