CymitQuimica logo

CAS 1006441-37-7

:

4-(Difluoromethyl)-6-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-(ethylsulfonyl)pyrimidine

Description:
4-(Difluoromethyl)-6-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-(ethylsulfonyl)pyrimidine is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine core substituted with various functional groups. The presence of a difluoromethyl group enhances its reactivity and potential biological activity, while the ethylsulfonyl moiety may contribute to its solubility and stability. The pyrazole ring, substituted with an ethyl and a methyl group, suggests potential interactions with biological targets, making this compound of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific pharmacological properties, possibly acting as an inhibitor or modulator in biochemical pathways. The compound's CAS number, 1006441-37-7, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound's unique combination of functional groups positions it as a candidate for further investigation in drug discovery and development.
Formula:C13H16F2N4O2S
InChI:InChI=1S/C13H16F2N4O2S/c1-4-19-7-9(8(3)18-19)10-6-11(12(14)15)17-13(16-10)22(20,21)5-2/h6-7,12H,4-5H2,1-3H3
InChI key:InChIKey=QZGPYOGRCRYVGW-UHFFFAOYSA-N
SMILES:CC=1C(=CN(CC)N1)C2=NC(S(CC)(=O)=O)=NC(C(F)F)=C2
Synonyms:
  • Pyrimidine, 4-(difluoromethyl)-6-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-(ethylsulfonyl)-
  • 4-(Difluoromethyl)-6-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-2-(ethylsulfonyl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.