CAS 1006453-95-7

3-[[[(1,5-Dimethyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-1H-pyrazole-1-propanoic acid

Description:

3-[[[(1,5-Dimethyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-1H-pyrazole-1-propanoic acid, with CAS number 1006453-95-7, is a chemical compound characterized by its complex structure, which includes multiple functional groups such as pyrazole rings and a propanoic acid moiety. This compound features a dimethyl-substituted pyrazole, which contributes to its potential biological activity. The presence of an amino group linked to a carbonyl enhances its reactivity and may influence its interaction with biological targets. The propanoic acid component suggests potential acidity, which can affect solubility and stability in various environments. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. Overall, the structural complexity and functional diversity of this compound suggest potential applications in therapeutic contexts, although detailed studies would be necessary to elucidate its full biological profile and mechanism of action.

Formula: C₁₃H₁₇N₅O₃

InChI: InChI=1S/C13H17N5O3/c1-9-10(8-15-17(9)2)7-14-13(21)11-3-5-18(16-11)6-4-12(19)20/h3,5,8H,4,6-7H2,1-2H3,(H,14,21)(H,19,20)

InChI key: InChIKey=IFIBMULQNQCRRX-UHFFFAOYSA-N

SMILES: C(NCC1=C(C)N(C)N=C1)(=O)C2=NN(CCC(O)=O)C=C2

Synonyms:

• 3-[[[(1,5-Dimethyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-1H-pyrazole-1-propanoic acid
• 1H-Pyrazole-1-propanoic acid, 3-[[[(1,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-

3-(3-{[(1,5-Dimethyl-1H-pyrazol-4-yl)methyl]carbamoyl}-1H-pyrazol-1-yl)propanoic acid

Controlled Product

CAS: 1006453-95-7

Versatile small molecule scaffold

Formula: C₁₃H₁₇N₅O₃

Purity: Min. 95%

Molecular weight: 291.31 g/mol

Ref: 3D-GQB45395