
CAS 1006464-13-6
:1,1′-Dimethyl[3,4′-bi-1H-pyrazol]-4-amine
Description:
1,1′-Dimethyl[3,4′-bi-1H-pyrazol]-4-amine is an organic compound characterized by its unique structure, which features a bi-pyrazole framework with two methyl groups attached to the nitrogen atoms. This compound typically exhibits properties associated with pyrazole derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of amine and pyrazole functional groups. It may be soluble in polar organic solvents, and its reactivity can be influenced by the electron-donating methyl groups. The compound's structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, due to its structural characteristics, it may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and efficacy. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H11N5
InChI:InChI=1S/C8H11N5/c1-12-4-6(3-10-12)8-7(9)5-13(2)11-8/h3-5H,9H2,1-2H3
InChI key:InChIKey=FAQUMSXOXGLUNI-UHFFFAOYSA-N
SMILES:NC=1C(=NN(C)C1)C2=CN(C)N=C2
Synonyms:- 1,1′-Dimethyl[3,4′-bi-1H-pyrazol]-4-amine
- [3,4′-Bi-1H-pyrazol]-4-amine, 1,1′-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.