CAS 1006464-16-9

1′-Methyl[3,4′-bi-1H-pyrazole]-1-acetic acid

Description:

1′-Methyl[3,4′-bi-1H-pyrazole]-1-acetic acid is a chemical compound characterized by its unique structure, which includes a bi-pyrazole framework and an acetic acid functional group. This compound typically exhibits properties associated with both pyrazole derivatives and carboxylic acids, such as potential acidity due to the carboxylic group and the ability to participate in hydrogen bonding. The presence of the methyl group at the 1′ position can influence its solubility and reactivity. In terms of applications, compounds with similar structures are often explored for their biological activities, including anti-inflammatory and analgesic properties. The molecular interactions of this compound may also be of interest in the development of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₉H₁₀N₄O₂

InChI: InChI=1S/C9H10N4O2/c1-12-5-7(4-10-12)8-2-3-13(11-8)6-9(14)15/h2-5H,6H2,1H3,(H,14,15)

InChI key: InChIKey=GYSHAQPPCYSWCM-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(C=C1)C=2C=NN(C)C2

Synonyms:

• 1′-Methyl[3,4′-bi-1H-pyrazole]-1-acetic acid
• [3,4′-Bi-1H-pyrazole]-1-acetic acid, 1′-methyl-

2-[3-(1-Methyl-1H-pyrazol-4-yl)-1H-pyrazol-1-yl]acetic acid

CAS: 1006464-16-9

Versatile small molecule scaffold

Formula: C₉H₁₀N₄O₂

Purity: Min. 95%

Molecular weight: 206.2 g/mol

Ref: 3D-GQB46416